C15H20BCl2NO4 — CID 158451832
[(1R)-2,2-dideuterio-1-[[4-(2,5-dichlorophenyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 158451832) has the molecular formula C15H20BCl2NO4 and a molecular weight of 362.06 g/mol. Its IUPAC name is [(1R)-2,2-dideuterio-1-[[4-(2,5-dichlorophenyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-2,2-dideuterio-1-[[4-(2,5-dichlorophenyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 158451832 |
| Molecular Formula | C15H20BCl2NO4 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(1R)-2,2-dideuterio-1-[[4-(2,5-dichlorophenyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | [2H]C([2H])(C(C)C)[C@H](NC(=O)CCC(=O)c1cc(Cl)ccc1Cl)B(O)O |
| InChI | InChI=1S/C15H20BCl2NO4/c1-9(2)7-14(16(22)23)19-15(21)6-5-13(20)11-8-10(17)3-4-12(11)18/h3-4,8-9,14,22-23H,5-7H2,1-2H3,(H,19,21)/t14-/m0/s1/i7D2 |
| InChIKey | XLIDMCDGJWRNIE-ATQGCBJHSA-N |
| XLogP | 2.50 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|