C51H90N2O19 — CID 158465003
2-[bis[5-(4,6-dioxoheptoxy)-2-oxopentyl]amino]-N-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxo-6-propoxyhexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 158465003) has the molecular formula C51H90N2O19 and a molecular weight of 1035.28 g/mol. Its IUPAC name is 2-[bis[5-(4,6-dioxoheptoxy)-2-oxopentyl]amino]-N-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxo-6-propoxyhexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-[bis[5-(4,6-dioxoheptoxy)-2-oxopentyl]amino]-N-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxo-6-propoxyhexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 158465003 |
| Molecular Formula | C51H90N2O19 |
| Molecular Weight | 1035.28 g/mol |
| Exact Mass | 1034.61 |
| IUPAC Name | 2-[bis[5-(4,6-dioxoheptoxy)-2-oxopentyl]amino]-N-[2-[2-[2-[2-[2-[2-[2-[2-(3-oxo-6-propoxyhexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CCCOCCCC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CN(CC(=O)CCCOCCCC(=O)CC(C)=O)CC(=O)CCCOCCCC(=O)CC(C)=O |
| InChI | InChI=1S/C51H90N2O19/c1-4-17-62-18-5-10-46(56)15-23-65-25-27-67-29-31-69-33-35-71-37-38-72-36-34-70-32-30-68-28-26-66-24-16-52-51(61)43-53(41-49(59)13-8-21-63-19-6-11-47(57)39-44(2)54)42-50(60)14-9-22-64-20-7-12-48(58)40-45(3)55/h4-43H2,1-3H3,(H,52,61) |
| InChIKey | ZNFSCICWGYBYPY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 253.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 59 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|