C21H26N4O5S — CID 158479370
5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-triazolo[1,5-d][1,4]diazonine-6,7-dione (PubChem CID 158479370) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is 5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-triazolo[1,5-d][1,4]diazonine-6,7-dione.
| Compound Name | 5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-triazolo[1,5-d][1,4]diazonine-6,7-dione |
|---|---|
| PubChem CID | 158479370 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-triazolo[1,5-d][1,4]diazonine-6,7-dione |
| SMILES | CC(C)C(CS(=O)(=O)c1ccccc1)C(=O)CC1Cc2cnnn2CCNC(=O)C1=O |
| InChI | InChI=1S/C21H26N4O5S/c1-14(2)18(13-31(29,30)17-6-4-3-5-7-17)19(26)11-15-10-16-12-23-24-25(16)9-8-22-21(28)20(15)27/h3-7,12,14-15,18H,8-11,13H2,1-2H3,(H,22,28) |
| InChIKey | HHIGFRTXSOTAQE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|