C22H27N3O5S — CID 162134807
5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-pyrazolo[1,5-d][1,4]diazonine-6,7-dione (PubChem CID 162134807) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is 5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-pyrazolo[1,5-d][1,4]diazonine-6,7-dione.
| Compound Name | 5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-pyrazolo[1,5-d][1,4]diazonine-6,7-dione |
|---|---|
| PubChem CID | 162134807 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 5-[3-(benzenesulfonylmethyl)-4-methyl-2-oxopentyl]-5,8,9,10-tetrahydro-4H-pyrazolo[1,5-d][1,4]diazonine-6,7-dione |
| SMILES | CC(C)C(CS(=O)(=O)c1ccccc1)C(=O)CC1Cc2ccnn2CCNC(=O)C1=O |
| InChI | InChI=1S/C22H27N3O5S/c1-15(2)19(14-31(29,30)18-6-4-3-5-7-18)20(26)13-16-12-17-8-9-24-25(17)11-10-23-22(28)21(16)27/h3-9,15-16,19H,10-14H2,1-2H3,(H,23,28) |
| InChIKey | ZJDCCXHRNXELCU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|