C30H33F3O2 — CID 158488483
2-[3-[2-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-7-phenylheptyl]phenyl]acetic acid (PubChem CID 158488483) has the molecular formula C30H33F3O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 2-[3-[2-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-7-phenylheptyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-7-phenylheptyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 158488483 |
| Molecular Formula | C30H33F3O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-[3-[2-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]-7-phenylheptyl]phenyl]acetic acid |
| SMILES | Cc1cc(CC(CCCCCc2ccccc2)Cc2cccc(CC(=O)O)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H33F3O2/c1-22-15-27(20-28(16-22)30(31,32)33)19-24(12-7-3-6-11-23-9-4-2-5-10-23)17-25-13-8-14-26(18-25)21-29(34)35/h2,4-5,8-10,13-16,18,20,24H,3,6-7,11-12,17,19,21H2,1H3,(H,34,35) |
| InChIKey | YWDIFPWISHFZIK-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|