C45H69BO3 — CID 158492954
1,3-bis(3,5-ditert-butylphenyl)propan-2-one;(2,5-ditert-butylphenyl)boronic acid (PubChem CID 158492954) has the molecular formula C45H69BO3 and a molecular weight of 668.86 g/mol. Its IUPAC name is 1,3-bis(3,5-ditert-butylphenyl)propan-2-one;(2,5-ditert-butylphenyl)boronic acid.
| Compound Name | 1,3-bis(3,5-ditert-butylphenyl)propan-2-one;(2,5-ditert-butylphenyl)boronic acid |
|---|---|
| PubChem CID | 158492954 |
| Molecular Formula | C45H69BO3 |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.53 |
| IUPAC Name | 1,3-bis(3,5-ditert-butylphenyl)propan-2-one;(2,5-ditert-butylphenyl)boronic acid |
| SMILES | CC(C)(C)c1cc(CC(=O)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.CC(C)(C)c1ccc(C(C)(C)C)c(B(O)O)c1 |
| InChI | InChI=1S/C31H46O.C14H23BO2/c1-28(2,3)23-13-21(14-24(19-23)29(4,5)6)17-27(32)18-22-15-25(30(7,8)9)20-26(16-22)31(10,11)12;1-13(2,3)10-7-8-11(14(4,5)6)12(9-10)15(16)17/h13-16,19-20H,17-18H2,1-12H3;7-9,16-17H,1-6H3 |
| InChIKey | HIXRVAZXNQRLFK-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|