C27H36O5 — CID 158494122
2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]-9H-fluoren-1-yl]acetic acid (PubChem CID 158494122) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]-9H-fluoren-1-yl]acetic acid.
| Compound Name | 2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]-9H-fluoren-1-yl]acetic acid |
|---|---|
| PubChem CID | 158494122 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]-9H-fluoren-1-yl]acetic acid |
| SMILES | CCCCC(CC)COCCOCCOc1ccc2c(c1CC(=O)O)Cc1ccccc1-2 |
| InChI | InChI=1S/C27H36O5/c1-3-5-8-20(4-2)19-31-14-13-30-15-16-32-26-12-11-23-22-10-7-6-9-21(22)17-24(23)25(26)18-27(28)29/h6-7,9-12,20H,3-5,8,13-19H2,1-2H3,(H,28,29) |
| InChIKey | PIISCYCVAINZBJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|