C20H23F3N2O3 — CID 158494246
(4aR,8aR)-6-[3-[4-(2,2,2-trifluoroethyl)phenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 158494246) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is (4aR,8aR)-6-[3-[4-(2,2,2-trifluoroethyl)phenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aR)-6-[3-[4-(2,2,2-trifluoroethyl)phenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 158494246 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (4aR,8aR)-6-[3-[4-(2,2,2-trifluoroethyl)phenyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@@H]2CCN(C(=O)N3CC(c4ccc(CC(F)(F)F)cc4)C3)C[C@H]2C1 |
| InChI | InChI=1S/C20H23F3N2O3/c21-20(22,23)8-13-1-3-14(4-2-13)16-10-25(11-16)19(27)24-6-5-18-15(9-24)7-17(26)12-28-18/h1-4,15-16,18H,5-12H2/t15-,18-/m1/s1 |
| InChIKey | HJBQVCQCIUHCBG-CRAIPNDOSA-N |
| XLogP | 2.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |