C32H37N2O8S2Si+ — CID 158507136
4-[[20-(3-formyloxypropyl)-2,2-dimethyl-20-aza-6-azonia-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-6-yl]methyl]benzenesulfonic acid;sulfur trioxide (PubChem CID 158507136) has the molecular formula C32H37N2O8S2Si+ and a molecular weight of 669.87 g/mol. Its IUPAC name is 4-[[20-(3-formyloxypropyl)-2,2-dimethyl-20-aza-6-azonia-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-6-yl]methyl]benzenesulfonic acid;sulfur trioxide.
| Compound Name | 4-[[20-(3-formyloxypropyl)-2,2-dimethyl-20-aza-6-azonia-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-6-yl]methyl]benzenesulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 158507136 |
| Molecular Formula | C32H37N2O8S2Si+ |
| Molecular Weight | 669.87 g/mol |
| Exact Mass | 669.18 |
| IUPAC Name | 4-[[20-(3-formyloxypropyl)-2,2-dimethyl-20-aza-6-azonia-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-6-yl]methyl]benzenesulfonic acid;sulfur trioxide |
| SMILES | C[Si]1(C)c2cc3c(cc2C=c2cc4c(cc21)=[N+](Cc1ccc(S(=O)(=O)O)cc1)CCC4)CCCN3CCCOC=O.O=S(=O)=O |
| InChI | InChI=1S/C32H36N2O5SSi.O3S/c1-41(2)31-19-29-24(6-3-12-33(29)14-5-15-39-22-35)16-26(31)18-27-17-25-7-4-13-34(30(25)20-32(27)41)21-23-8-10-28(11-9-23)40(36,37)38;1-4(2)3/h8-11,16-20,22H,3-7,12-15,21H2,1-2H3;/p+1 |
| InChIKey | HKPDSOOIIRQLRE-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.87 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|