C36H38Cl2N2O4 — CID 118515780
2-[20-(5-carboxypentyl)-2,2,6-trimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-3,6-dichlorobenzoate (PubChem CID 118515780) has the molecular formula C36H38Cl2N2O4 and a molecular weight of 633.62 g/mol. Its IUPAC name is 2-[20-(5-carboxypentyl)-2,2,6-trimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-3,6-dichlorobenzoate.
| Compound Name | 2-[20-(5-carboxypentyl)-2,2,6-trimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-3,6-dichlorobenzoate |
|---|---|
| PubChem CID | 118515780 |
| Molecular Formula | C36H38Cl2N2O4 |
| Molecular Weight | 633.62 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 2-[20-(5-carboxypentyl)-2,2,6-trimethyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl]-3,6-dichlorobenzoate |
| SMILES | C[N+]1=c2cc3c(cc2CCC1)=C(c1c(Cl)ccc(Cl)c1C(=O)[O-])c1cc2c(cc1C3(C)C)N(CCCCCC(=O)O)CCC2 |
| InChI | InChI=1S/C36H38Cl2N2O4/c1-36(2)25-19-29-21(9-7-14-39(29)3)17-23(25)32(33-27(37)12-13-28(38)34(33)35(43)44)24-18-22-10-8-16-40(30(22)20-26(24)36)15-6-4-5-11-31(41)42/h12-13,17-20H,4-11,14-16H2,1-3H3,(H-,41,42,43,44) |
| InChIKey | LHOPTEFINFSGKM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|