About azido(trimethyl)silane;3-triethoxysilylpropan-1-amine
azido(trimethyl)silane;3-triethoxysilylpropan-1-amine (PubChem CID 158510723) has the molecular formula C12H32N4O3Si2
and a molecular weight of 336.59 g/mol. Its IUPAC name is azido(trimethyl)silane;3-triethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | azido(trimethyl)silane;3-triethoxysilylpropan-1-amine |
| PubChem CID | 158510723 |
| Molecular Formula | C12H32N4O3Si2 |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | azido(trimethyl)silane;3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OCC.C[Si](C)(C)N=[N+]=[N-] |
| InChI | InChI=1S/C9H23NO3Si.C3H9N3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-7(2,3)6-5-4/h4-10H2,1-3H3;1-3H3 |
| InChIKey | HLAAIOWRDATDHX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azido(trimethyl)silane;3-triethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido(trimethyl)silane;3-triethoxysilylpropan-1-amine?
The IUPAC name of azido(trimethyl)silane;3-triethoxysilylpropan-1-amine (CID 158510723) is azido(trimethyl)silane;3-triethoxysilylpropan-1-amine.
What is the SMILES notation for azido(trimethyl)silane;3-triethoxysilylpropan-1-amine?
The canonical SMILES for azido(trimethyl)silane;3-triethoxysilylpropan-1-amine is CCO[Si](CCCN)(OCC)OCC.C[Si](C)(C)N=[N+]=[N-].
What is the InChIKey of azido(trimethyl)silane;3-triethoxysilylpropan-1-amine?
The InChIKey is HLAAIOWRDATDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO3Si.C3H9N3Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-7(2,3)6-5-4/h4-10H2,1-3H3;1-3H3.
What are the key properties of azido(trimethyl)silane;3-triethoxysilylpropan-1-amine?
azido(trimethyl)silane;3-triethoxysilylpropan-1-amine has a molecular weight of 336.59 g/mol, XLogP of 3.52, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azido(trimethyl)silane;3-triethoxysilylpropan-1-amine is sourced from PubChem (CID 158510723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).