C29H22O2 — CID 158511219
10H-anthracen-9-one;(E)-1,3-diphenylprop-2-en-1-one (PubChem CID 158511219) has the molecular formula C29H22O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is 10H-anthracen-9-one;(E)-1,3-diphenylprop-2-en-1-one.
| Compound Name | 10H-anthracen-9-one;(E)-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 158511219 |
| Molecular Formula | C29H22O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 10H-anthracen-9-one;(E)-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1ccccc1.O=C1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C15H12O.C14H10O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-12H;1-8H,9H2/b12-11+; |
| InChIKey | HLBRCVUYGGOQHT-CALJPSDSSA-N |
| XLogP | 6.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|