C29H32N4O5S — CID 158512724
1-[4-[4-benzo[b][1,4]benzothiazepin-6-yl-1-[2-(2-hydroxyethoxy)ethyl]piperazin-2-yl]-2-oxobutyl]pyrrole-2,5-dione (PubChem CID 158512724) has the molecular formula C29H32N4O5S and a molecular weight of 548.67 g/mol. Its IUPAC name is 1-[4-[4-benzo[b][1,4]benzothiazepin-6-yl-1-[2-(2-hydroxyethoxy)ethyl]piperazin-2-yl]-2-oxobutyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[4-benzo[b][1,4]benzothiazepin-6-yl-1-[2-(2-hydroxyethoxy)ethyl]piperazin-2-yl]-2-oxobutyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158512724 |
| Molecular Formula | C29H32N4O5S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 1-[4-[4-benzo[b][1,4]benzothiazepin-6-yl-1-[2-(2-hydroxyethoxy)ethyl]piperazin-2-yl]-2-oxobutyl]pyrrole-2,5-dione |
| SMILES | O=C(CCC1CN(C2=Nc3ccccc3Sc3ccccc32)CCN1CCOCCO)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C29H32N4O5S/c34-16-18-38-17-15-31-13-14-32(19-21(31)9-10-22(35)20-33-27(36)11-12-28(33)37)29-23-5-1-3-7-25(23)39-26-8-4-2-6-24(26)30-29/h1-8,11-12,21,34H,9-10,13-20H2 |
| InChIKey | HMJCFOWMWBESET-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|