C17H21N3O6 — CID 158513913
ethyl 2-[2,5-bis(aziridin-1-yl)-4-(ethoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate (PubChem CID 158513913) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is ethyl 2-[2,5-bis(aziridin-1-yl)-4-(ethoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate.
| Compound Name | ethyl 2-[2,5-bis(aziridin-1-yl)-4-(ethoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate |
|---|---|
| PubChem CID | 158513913 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | ethyl 2-[2,5-bis(aziridin-1-yl)-4-(ethoxycarbonylamino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetate |
| SMILES | CCOC(=O)CC1=C(N2CC2)C(=O)C(NC(=O)OCC)=C(N2CC2)C1=O |
| InChI | InChI=1S/C17H21N3O6/c1-3-25-11(21)9-10-13(19-5-6-19)16(23)12(18-17(24)26-4-2)14(15(10)22)20-7-8-20/h3-9H2,1-2H3,(H,18,24) |
| InChIKey | HLJYGPPEBYIRMI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|