C14H20N4O6 — CID 15851486
diethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate (PubChem CID 15851486) has the molecular formula C14H20N4O6 and a molecular weight of 340.34 g/mol. Its IUPAC name is diethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate.
| Compound Name | diethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15851486 |
| Molecular Formula | C14H20N4O6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | diethyl 6,8-dimethyl-5,7-dioxo-1,2,3,4-tetrahydropyrimido[4,5-c]pyridazine-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1NNc2c(c(=O)n(C)c(=O)n2C)C1C(=O)OCC |
| InChI | InChI=1S/C14H20N4O6/c1-5-23-12(20)7-8-10(16-15-9(7)13(21)24-6-2)17(3)14(22)18(4)11(8)19/h7,9,15-16H,5-6H2,1-4H3 |
| InChIKey | IPCHAKUSCJBHMY-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |