About CID 158526623
CID 158526623 (PubChem CID 158526623) has the molecular formula C48H65B3BrN2O6
and a molecular weight of 878.40 g/mol.
Molecular Properties
| Compound Name | CID 158526623 |
| PubChem CID | 158526623 |
| Molecular Formula | C48H65B3BrN2O6 |
| Molecular Weight | 878.40 g/mol |
| Exact Mass | 877.43 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]B1OC(C)(C)C(C)(C)O1.CC1(C)c2ccccc2Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc21.CC1(C)c2ccccc2Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C21H26BNO2.C15H14BrN.C12H25B2O4/c1-19(2)15-9-7-8-10-17(15)23-18-12-11-14(13-16(18)19)22-24-20(3,4)21(5,6)25-22;1-15(2)11-5-3-4-6-13(11)17-14-8-7-10(16)9-12(14)15;1-9(2,15)10(3,4)16-13-14-17-11(5,6)12(7,8)18-14/h7-13,23H,1-6H3;3-9,17H,1-2H3;15H,1-8H3 |
| InChIKey | IJOHCAOLTQCGJU-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 878.40 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158526623 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158526623?
The IUPAC name of CID 158526623 (CID 158526623) is not available.
What is the SMILES notation for CID 158526623?
The canonical SMILES for CID 158526623 is CC(C)(O)C(C)(C)O[B]B1OC(C)(C)C(C)(C)O1.CC1(C)c2ccccc2Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc21.CC1(C)c2ccccc2Nc2ccc(Br)cc21.
What is the InChIKey of CID 158526623?
The InChIKey is IJOHCAOLTQCGJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26BNO2.C15H14BrN.C12H25B2O4/c1-19(2)15-9-7-8-10-17(15)23-18-12-11-14(13-16(18)19)22-24-20(3,4)21(5,6)25-22;1-15(2)11-5-3-4-6-13(11)17-14-8-7-10(16)9-12(14)15;1-9(2,15)10(3,4)16-13-14-17-11(5,6)12(7,8)18-14/h7-13,23H,1-6H3;3-9,17H,1-2H3;15H,1-8H3.
What are the key properties of CID 158526623?
CID 158526623 has a molecular weight of 878.40 g/mol, XLogP of 10.96, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158526623 is sourced from PubChem (CID 158526623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).