C18H20NO+ — CID 158529197
2-methyl-3-phenyl-8-propan-2-yl-2H-1,3-benzoxazin-3-ium (PubChem CID 158529197) has the molecular formula C18H20NO+ and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-methyl-3-phenyl-8-propan-2-yl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 2-methyl-3-phenyl-8-propan-2-yl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 158529197 |
| Molecular Formula | C18H20NO+ |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-methyl-3-phenyl-8-propan-2-yl-2H-1,3-benzoxazin-3-ium |
| SMILES | CC(C)c1cccc2c1OC(C)[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C18H20NO/c1-13(2)17-11-7-8-15-12-19(14(3)20-18(15)17)16-9-5-4-6-10-16/h4-14H,1-3H3/q+1 |
| InChIKey | HSPGSNSFACBTKG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|