C48H77FN2O3Si2 — CID 158540474
5-[bis(2-methylpropyl)-(4-phenylbutoxy)silyl]-N-phenylpentanamide;5-[fluoro-bis(2-methylpropyl)silyl]-N-phenylpentanamide (PubChem CID 158540474) has the molecular formula C48H77FN2O3Si2 and a molecular weight of 805.33 g/mol. Its IUPAC name is 5-[bis(2-methylpropyl)-(4-phenylbutoxy)silyl]-N-phenylpentanamide;5-[fluoro-bis(2-methylpropyl)silyl]-N-phenylpentanamide.
| Compound Name | 5-[bis(2-methylpropyl)-(4-phenylbutoxy)silyl]-N-phenylpentanamide;5-[fluoro-bis(2-methylpropyl)silyl]-N-phenylpentanamide |
|---|---|
| PubChem CID | 158540474 |
| Molecular Formula | C48H77FN2O3Si2 |
| Molecular Weight | 805.33 g/mol |
| Exact Mass | 804.55 |
| IUPAC Name | 5-[bis(2-methylpropyl)-(4-phenylbutoxy)silyl]-N-phenylpentanamide;5-[fluoro-bis(2-methylpropyl)silyl]-N-phenylpentanamide |
| SMILES | CC(C)C[Si](CCCCC(=O)Nc1ccccc1)(CC(C)C)OCCCCc1ccccc1.CC(C)C[Si](F)(CCCCC(=O)Nc1ccccc1)CC(C)C |
| InChI | InChI=1S/C29H45NO2Si.C19H32FNOSi/c1-25(2)23-33(24-26(3)4,32-21-13-11-17-27-15-7-5-8-16-27)22-14-12-20-29(31)30-28-18-9-6-10-19-28;1-16(2)14-23(20,15-17(3)4)13-9-8-12-19(22)21-18-10-6-5-7-11-18/h5-10,15-16,18-19,25-26H,11-14,17,20-24H2,1-4H3,(H,30,31);5-7,10-11,16-17H,8-9,12-15H2,1-4H3,(H,21,22) |
| InChIKey | HOLKJDGQOBSTQA-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.33 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|