C18H18O6 — CID 15854372
methyl (1R,9S,10R)-4-methoxy-2,16-dioxo-15-oxatetracyclo[7.5.2.01,10.03,8]hexadeca-3(8),4,6-triene-9-carboxylate (PubChem CID 15854372) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl (1R,9S,10R)-4-methoxy-2,16-dioxo-15-oxatetracyclo[7.5.2.01,10.03,8]hexadeca-3(8),4,6-triene-9-carboxylate.
| Compound Name | methyl (1R,9S,10R)-4-methoxy-2,16-dioxo-15-oxatetracyclo[7.5.2.01,10.03,8]hexadeca-3(8),4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 15854372 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl (1R,9S,10R)-4-methoxy-2,16-dioxo-15-oxatetracyclo[7.5.2.01,10.03,8]hexadeca-3(8),4,6-triene-9-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)O[C@@]3(CCCC[C@H]13)C(=O)c1c(OC)cccc12 |
| InChI | InChI=1S/C18H18O6/c1-22-11-7-5-6-10-13(11)14(19)17-9-4-3-8-12(17)18(10,15(20)23-2)16(21)24-17/h5-7,12H,3-4,8-9H2,1-2H3/t12-,17+,18+/m0/s1 |
| InChIKey | NWVWPPBKMPEQLP-JBBXEZCESA-N |
| XLogP | 1.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|