C22H20N4O3 — CID 158543819
2-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]-1,5,5a,6,7,8,9,9a-octahydropyrrolo[3,2-h]isoquinolin-4-one (PubChem CID 158543819) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]-1,5,5a,6,7,8,9,9a-octahydropyrrolo[3,2-h]isoquinolin-4-one.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]-1,5,5a,6,7,8,9,9a-octahydropyrrolo[3,2-h]isoquinolin-4-one |
|---|---|
| PubChem CID | 158543819 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)pyrimidin-4-yl]-1,5,5a,6,7,8,9,9a-octahydropyrrolo[3,2-h]isoquinolin-4-one |
| SMILES | O=C1CC2CCNCC2c2[nH]c(-c3ccnc(-c4ccc5c(c4)OCO5)n3)cc21 |
| InChI | InChI=1S/C22H20N4O3/c27-18-7-12-3-5-23-10-15(12)21-14(18)9-17(25-21)16-4-6-24-22(26-16)13-1-2-19-20(8-13)29-11-28-19/h1-2,4,6,8-9,12,15,23,25H,3,5,7,10-11H2 |
| InChIKey | MFJMBSFAIYPADA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |