C28H31N3O — CID 158546718
4-[(3Z,5E,7E)-3-ethenyl-8-[3-[(E)-2-(3H-inden-5-yl)ethenyl]-1H-pyrazol-5-yl]octa-3,5,7-trienyl]morpholine (PubChem CID 158546718) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is 4-[(3Z,5E,7E)-3-ethenyl-8-[3-[(E)-2-(3H-inden-5-yl)ethenyl]-1H-pyrazol-5-yl]octa-3,5,7-trienyl]morpholine.
| Compound Name | 4-[(3Z,5E,7E)-3-ethenyl-8-[3-[(E)-2-(3H-inden-5-yl)ethenyl]-1H-pyrazol-5-yl]octa-3,5,7-trienyl]morpholine |
|---|---|
| PubChem CID | 158546718 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 4-[(3Z,5E,7E)-3-ethenyl-8-[3-[(E)-2-(3H-inden-5-yl)ethenyl]-1H-pyrazol-5-yl]octa-3,5,7-trienyl]morpholine |
| SMILES | C=C/C(=C\C=C\C=C\c1cc(/C=C/c2ccc3c(c2)CC=C3)n[nH]1)CCN1CCOCC1 |
| InChI | InChI=1S/C28H31N3O/c1-2-23(15-16-31-17-19-32-20-18-31)7-4-3-5-10-27-22-28(30-29-27)14-12-24-11-13-25-8-6-9-26(25)21-24/h2-8,10-14,21-22H,1,9,15-20H2,(H,29,30)/b4-3+,10-5+,14-12+,23-7+ |
| InChIKey | HPEYIAFWZYMXQV-YXQONFKDSA-N |
| XLogP | 5.55 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|