C9H20OS — CID 158555993
[(2R)-2,4-dimethylpentyl]-methyl-methylidene-oxo-λ6-sulfane (PubChem CID 158555993) has the molecular formula C9H20OS and a molecular weight of 176.32 g/mol. Its IUPAC name is [(2R)-2,4-dimethylpentyl]-methyl-methylidene-oxo-λ6-sulfane.
| Compound Name | [(2R)-2,4-dimethylpentyl]-methyl-methylidene-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 158555993 |
| Molecular Formula | C9H20OS |
| Molecular Weight | 176.32 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | [(2R)-2,4-dimethylpentyl]-methyl-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(C)(=O)C[C@H](C)CC(C)C |
| InChI | InChI=1S/C9H20OS/c1-8(2)6-9(3)7-11(4,5)10/h8-9H,4,6-7H2,1-3,5H3/t9-,11?/m1/s1 |
| InChIKey | JMMPFLBNTKIOII-BFHBGLAWSA-N |
| XLogP | 2.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|