C28H20N4O3 — CID 15856237
6-imino-5-(4-methoxyphenyl)-1-(4-methylphenyl)-2,3-dioxo-4-phenylpyrrolo[3,2-c]pyridine-7-carbonitrile (PubChem CID 15856237) has the molecular formula C28H20N4O3 and a molecular weight of 460.49 g/mol. Its IUPAC name is 6-imino-5-(4-methoxyphenyl)-1-(4-methylphenyl)-2,3-dioxo-4-phenylpyrrolo[3,2-c]pyridine-7-carbonitrile.
| Compound Name | 6-imino-5-(4-methoxyphenyl)-1-(4-methylphenyl)-2,3-dioxo-4-phenylpyrrolo[3,2-c]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 15856237 |
| Molecular Formula | C28H20N4O3 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 6-imino-5-(4-methoxyphenyl)-1-(4-methylphenyl)-2,3-dioxo-4-phenylpyrrolo[3,2-c]pyridine-7-carbonitrile |
| SMILES | [H]/N=c1\c(C#N)c2c(c(-c3ccccc3)n1-c1ccc(OC)cc1)C(=O)C(=O)N2c1ccc(C)cc1 |
| InChI | InChI=1S/C28H20N4O3/c1-17-8-10-20(11-9-17)32-25-22(16-29)27(30)31(19-12-14-21(35-2)15-13-19)24(18-6-4-3-5-7-18)23(25)26(33)28(32)34/h3-15,30H,1-2H3/b30-27+ |
| InChIKey | SLDFLQWDGNZRDI-KDJFERLWSA-N |
| XLogP | 4.67 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|