About 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole
1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole (PubChem CID 158562894) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole |
| PubChem CID | 158562894 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole |
| SMILES | Cc1cc2c(cc1COCCN1CCCC1)[nH]c1ccnc(C)c12 |
| InChI | InChI=1S/C20H25N3O/c1-14-11-17-19(22-18-5-6-21-15(2)20(17)18)12-16(14)13-24-10-9-23-7-3-4-8-23/h5-6,11-12,22H,3-4,7-10,13H2,1-2H3 |
| InChIKey | HRCKIXBXQJXVMF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole?
The IUPAC name of 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole (CID 158562894) is 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole.
What is the SMILES notation for 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole?
The canonical SMILES for 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole is Cc1cc2c(cc1COCCN1CCCC1)[nH]c1ccnc(C)c12.
What is the InChIKey of 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole?
The InChIKey is HRCKIXBXQJXVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-14-11-17-19(22-18-5-6-21-15(2)20(17)18)12-16(14)13-24-10-9-23-7-3-4-8-23/h5-6,11-12,22H,3-4,7-10,13H2,1-2H3.
What are the key properties of 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole?
1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole has a molecular weight of 323.44 g/mol, XLogP of 3.95, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole is sourced from PubChem (CID 158562894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).