C20H25N3O — CID 158562894
1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole (PubChem CID 158562894) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole.
| Compound Name | 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 158562894 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1,8-dimethyl-7-(2-pyrrolidin-1-ylethoxymethyl)-5H-pyrido[4,3-b]indole |
| SMILES | Cc1cc2c(cc1COCCN1CCCC1)[nH]c1ccnc(C)c12 |
| InChI | InChI=1S/C20H25N3O/c1-14-11-17-19(22-18-5-6-21-15(2)20(17)18)12-16(14)13-24-10-9-23-7-3-4-8-23/h5-6,11-12,22H,3-4,7-10,13H2,1-2H3 |
| InChIKey | HRCKIXBXQJXVMF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|