C28H30F3N5O2 — CID 158565001
methane;(2R,10E)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3,4,5-trifluorophenyl)-7-oxa-1,4,8-triazatricyclo[7.4.0.02,6]tridec-8-ene (PubChem CID 158565001) has the molecular formula C28H30F3N5O2 and a molecular weight of 525.58 g/mol. Its IUPAC name is methane;(2R,10E)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3,4,5-trifluorophenyl)-7-oxa-1,4,8-triazatricyclo[7.4.0.02,6]tridec-8-ene.
| Compound Name | methane;(2R,10E)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3,4,5-trifluorophenyl)-7-oxa-1,4,8-triazatricyclo[7.4.0.02,6]tridec-8-ene |
|---|---|
| PubChem CID | 158565001 |
| Molecular Formula | C28H30F3N5O2 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | methane;(2R,10E)-10-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-2-(3,4,5-trifluorophenyl)-7-oxa-1,4,8-triazatricyclo[7.4.0.02,6]tridec-8-ene |
| SMILES | C.COc1cc(/C=C2\CCCN3C2=NOC2CNC[C@]23c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H26F3N5O2.CH4/c1-16-13-34(15-32-16)22-6-5-17(9-23(22)36-2)8-18-4-3-7-35-26(18)33-37-24-12-31-14-27(24,35)19-10-20(28)25(30)21(29)11-19;/h5-6,8-11,13,15,24,31H,3-4,7,12,14H2,1-2H3;1H4/b18-8+;/t24?,27-;/m0./s1 |
| InChIKey | HRJAUJGZBSLLKW-OJLZWUJJSA-N |
| XLogP | 4.93 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|