C22H40N2O4 — CID 158567206
6-methyl-N-(2-methyl-5-oxononan-4-yl)-4-oxo-2-propan-2-yl-5-(tritiocarbonylamino)heptanamide (PubChem CID 158567206) has the molecular formula C22H40N2O4 and a molecular weight of 398.58 g/mol. Its IUPAC name is 6-methyl-N-(2-methyl-5-oxononan-4-yl)-4-oxo-2-propan-2-yl-5-(tritiocarbonylamino)heptanamide.
| Compound Name | 6-methyl-N-(2-methyl-5-oxononan-4-yl)-4-oxo-2-propan-2-yl-5-(tritiocarbonylamino)heptanamide |
|---|---|
| PubChem CID | 158567206 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | 6-methyl-N-(2-methyl-5-oxononan-4-yl)-4-oxo-2-propan-2-yl-5-(tritiocarbonylamino)heptanamide |
| SMILES | [3H]C(=O)NC(C(=O)CC(C(=O)NC(CC(C)C)C(=O)CCCC)C(C)C)C(C)C |
| InChI | InChI=1S/C22H40N2O4/c1-8-9-10-19(26)18(11-14(2)3)24-22(28)17(15(4)5)12-20(27)21(16(6)7)23-13-25/h13-18,21H,8-12H2,1-7H3,(H,23,25)(H,24,28)/i13T |
| InChIKey | USIBQCHBELYFRT-IYFSJMEXSA-N |
| XLogP | 3.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|