C37H71N7O3 — CID 158567554
1-[2-(cyclohexylamino)ethyl]-3,3,4,5,5-pentamethylpiperazin-2-one;3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 158567554) has the molecular formula C37H71N7O3 and a molecular weight of 662.02 g/mol. Its IUPAC name is 1-[2-(cyclohexylamino)ethyl]-3,3,4,5,5-pentamethylpiperazin-2-one;3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 1-[2-(cyclohexylamino)ethyl]-3,3,4,5,5-pentamethylpiperazin-2-one;3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 158567554 |
| Molecular Formula | C37H71N7O3 |
| Molecular Weight | 662.02 g/mol |
| Exact Mass | 661.56 |
| IUPAC Name | 1-[2-(cyclohexylamino)ethyl]-3,3,4,5,5-pentamethylpiperazin-2-one;3,3,4,5,5-pentamethyl-1-[2-(3,3,4,5,5-pentamethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | CN1C(C)(C)CN(CCN2CC(C)(C)N(C)C(C)(C)C2=O)C(=O)C1(C)C.CN1C(C)(C)CN(CCNC2CCCCC2)C(=O)C1(C)C |
| InChI | InChI=1S/C20H38N4O2.C17H33N3O/c1-17(2)13-23(15(25)19(5,6)21(17)9)11-12-24-14-18(3,4)22(10)20(7,8)16(24)26;1-16(2)13-20(15(21)17(3,4)19(16)5)12-11-18-14-9-7-6-8-10-14/h11-14H2,1-10H3;14,18H,6-13H2,1-5H3 |
| InChIKey | HRRBAKOEFKYJGM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.02 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |