C27H22N4O3+2 — CID 158569439
5-N,5-N,23-N,23-N-tetramethyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene-5,23-diamine (PubChem CID 158569439) has the molecular formula C27H22N4O3+2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 5-N,5-N,23-N,23-N-tetramethyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene-5,23-diamine.
| Compound Name | 5-N,5-N,23-N,23-N-tetramethyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene-5,23-diamine |
|---|---|
| PubChem CID | 158569439 |
| Molecular Formula | C27H22N4O3+2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 5-N,5-N,23-N,23-N-tetramethyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene-5,23-diamine |
| SMILES | CN(C)c1cc2[n+]3c(c1)-c1cc(N(C)C)cc4[n+]1C31c3c(cccc3O2)Oc2cccc(c21)O4 |
| InChI | InChI=1S/C27H22N4O3/c1-28(2)15-11-17-18-12-16(29(3)4)14-24-31(18)27-25-19(32-20-8-6-10-22(34-24)26(20)27)7-5-9-21(25)33-23(13-15)30(17)27/h5-14H,1-4H3/q+2 |
| InChIKey | IUTZKMXMNLEFJP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|