C35H20N2O3+2 — CID 158344690
5,23-diphenyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene (PubChem CID 158344690) has the molecular formula C35H20N2O3+2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 5,23-diphenyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene.
| Compound Name | 5,23-diphenyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene |
|---|---|
| PubChem CID | 158344690 |
| Molecular Formula | C35H20N2O3+2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 5,23-diphenyl-8,14,20-trioxa-2,26-diazoniaoctacyclo[13.11.1.11,9.02,7.03,25.019,27.021,26.013,28]octacosa-2,4,6,9,11,13(28),15(27),16,18,21,23,25-dodecaene |
| SMILES | c1ccc(-c2cc3[n+]4c(c2)-c2cc(-c5ccccc5)cc5[n+]2C42c4c(cccc4O3)Oc3cccc(c32)O5)cc1 |
| InChI | InChI=1S/C35H20N2O3/c1-3-9-21(10-4-1)23-17-25-26-18-24(22-11-5-2-6-12-22)20-32-37(26)35-33-27(38-28-14-8-16-30(40-32)34(28)35)13-7-15-29(33)39-31(19-23)36(25)35/h1-20H/q+2 |
| InChIKey | HGVVSVZPESDBEW-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 35.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|