C26H24O4S — CID 15857549
3-(benzenesulfonyl)-7,8,10,12-tetramethylbenzo[a]heptalene-2,4-diol (PubChem CID 15857549) has the molecular formula C26H24O4S and a molecular weight of 432.54 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-7,8,10,12-tetramethylbenzo[a]heptalene-2,4-diol.
| Compound Name | 3-(benzenesulfonyl)-7,8,10,12-tetramethylbenzo[a]heptalene-2,4-diol |
|---|---|
| PubChem CID | 15857549 |
| Molecular Formula | C26H24O4S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-(benzenesulfonyl)-7,8,10,12-tetramethylbenzo[a]heptalene-2,4-diol |
| SMILES | CC1=CC(C)=C2C(C)=CC=c3c(O)c(S(=O)(=O)c4ccccc4)c(O)cc3=C2C(C)=C1 |
| InChI | InChI=1S/C26H24O4S/c1-15-12-17(3)23-16(2)10-11-20-21(24(23)18(4)13-15)14-22(27)26(25(20)28)31(29,30)19-8-6-5-7-9-19/h5-14,27-28H,1-4H3 |
| InChIKey | ZXHNYTPOUSNSPC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |