C17H22O3S — CID 135049709
3-(benzenesulfonyl)-4-methyl-1-(3-methylbut-2-en-2-yl)cyclopent-2-en-1-ol (PubChem CID 135049709) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-methyl-1-(3-methylbut-2-en-2-yl)cyclopent-2-en-1-ol.
| Compound Name | 3-(benzenesulfonyl)-4-methyl-1-(3-methylbut-2-en-2-yl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 135049709 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-(benzenesulfonyl)-4-methyl-1-(3-methylbut-2-en-2-yl)cyclopent-2-en-1-ol |
| SMILES | CC(C)=C(C)C1(O)C=C(S(=O)(=O)c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C17H22O3S/c1-12(2)14(4)17(18)10-13(3)16(11-17)21(19,20)15-8-6-5-7-9-15/h5-9,11,13,18H,10H2,1-4H3 |
| InChIKey | MKLAIYZLNHOXFW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|