C27H38Cl2N2O3 — CID 158578751
N-[3-(2,4-dichlorophenyl)propyl]decan-1-amine;2,3-dihydrofuro[2,3-b]pyridine-3-carboxylic acid (PubChem CID 158578751) has the molecular formula C27H38Cl2N2O3 and a molecular weight of 509.52 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenyl)propyl]decan-1-amine;2,3-dihydrofuro[2,3-b]pyridine-3-carboxylic acid.
| Compound Name | N-[3-(2,4-dichlorophenyl)propyl]decan-1-amine;2,3-dihydrofuro[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 158578751 |
| Molecular Formula | C27H38Cl2N2O3 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | N-[3-(2,4-dichlorophenyl)propyl]decan-1-amine;2,3-dihydrofuro[2,3-b]pyridine-3-carboxylic acid |
| SMILES | CCCCCCCCCCNCCCc1ccc(Cl)cc1Cl.O=C(O)C1COc2ncccc21 |
| InChI | InChI=1S/C19H31Cl2N.C8H7NO3/c1-2-3-4-5-6-7-8-9-14-22-15-10-11-17-12-13-18(20)16-19(17)21;10-8(11)6-4-12-7-5(6)2-1-3-9-7/h12-13,16,22H,2-11,14-15H2,1H3;1-3,6H,4H2,(H,10,11) |
| InChIKey | HSZGADWJFHTSCV-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|