C20H28O2 — CID 158597614
(2S,4R,4aS,7R,8R,8aR)-8-[(E)-2-(furan-3-yl)ethenyl]-2,4,4a,7-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 158597614) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2S,4R,4aS,7R,8R,8aR)-8-[(E)-2-(furan-3-yl)ethenyl]-2,4,4a,7-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | (2S,4R,4aS,7R,8R,8aR)-8-[(E)-2-(furan-3-yl)ethenyl]-2,4,4a,7-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 158597614 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (2S,4R,4aS,7R,8R,8aR)-8-[(E)-2-(furan-3-yl)ethenyl]-2,4,4a,7-tetramethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | C[C@@H]1CC[C@@]2(C)[C@H](C)C[C@H](C)C(=O)[C@@H]2[C@H]1/C=C/c1ccoc1 |
| InChI | InChI=1S/C20H28O2/c1-13-7-9-20(4)15(3)11-14(2)19(21)18(20)17(13)6-5-16-8-10-22-12-16/h5-6,8,10,12-15,17-18H,7,9,11H2,1-4H3/b6-5+/t13-,14+,15-,17+,18+,20+/m1/s1 |
| InChIKey | XRCCGNXEACAMNH-AVCSMEEYSA-N |
| XLogP | 5.21 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |