C33H23IN2O2S6 — CID 158603850
2,5-dimethyl-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione;iodomethane (PubChem CID 158603850) has the molecular formula C33H23IN2O2S6 and a molecular weight of 798.87 g/mol. Its IUPAC name is 2,5-dimethyl-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione;iodomethane.
| Compound Name | 2,5-dimethyl-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione;iodomethane |
|---|---|
| PubChem CID | 158603850 |
| Molecular Formula | C33H23IN2O2S6 |
| Molecular Weight | 798.87 g/mol |
| Exact Mass | 797.91 |
| IUPAC Name | 2,5-dimethyl-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione;iodomethane |
| SMILES | CI.CN1C(=O)C2=C(c3ccc(-c4ccc(-c5cccs5)s4)s3)N(C)C(=O)C2=C1c1ccc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C32H20N2O2S6.CH3I/c1-33-29(25-13-11-23(41-25)21-9-7-19(39-21)17-5-3-15-37-17)27-28(31(33)35)30(34(2)32(27)36)26-14-12-24(42-26)22-10-8-20(40-22)18-6-4-16-38-18;1-2/h3-16H,1-2H3;1H3 |
| InChIKey | HVYWARPTAIORSE-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.87 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|