About 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride
4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride (PubChem CID 158614398) has the molecular formula C13H11ClN4O11S2
and a molecular weight of 498.84 g/mol. Its IUPAC name is 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride.
Molecular Properties
| Compound Name | 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride |
| PubChem CID | 158614398 |
| Molecular Formula | C13H11ClN4O11S2 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride |
| SMILES | NS(=O)(=O)Oc1ccc([N+](=O)[O-])cc1.O=C=NS(=O)(=O)Cl.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C6H6N2O5S.C6H5NO3.CClNO3S/c7-14(11,12)13-6-3-1-5(2-4-6)8(9)10;8-6-3-1-5(2-4-6)7(9)10;2-7(5,6)3-1-4/h1-4H,(H2,7,11,12);1-4,8H; |
| InChIKey | HXFFSPCQBAFNFF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 239.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride?
The IUPAC name of 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride (CID 158614398) is 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride.
What is the SMILES notation for 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride?
The canonical SMILES for 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride is NS(=O)(=O)Oc1ccc([N+](=O)[O-])cc1.O=C=NS(=O)(=O)Cl.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride?
The InChIKey is HXFFSPCQBAFNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O5S.C6H5NO3.CClNO3S/c7-14(11,12)13-6-3-1-5(2-4-6)8(9)10;8-6-3-1-5(2-4-6)7(9)10;2-7(5,6)3-1-4/h1-4H,(H2,7,11,12);1-4,8H;.
What are the key properties of 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride?
4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride has a molecular weight of 498.84 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrophenol;(4-nitrophenyl) sulfamate;N-(oxomethylidene)sulfamoyl chloride is sourced from PubChem (CID 158614398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).