C26H20N4O4 — CID 158617615
2-[3-[hydroxy-(3-nitrophenyl)methyl]phenyl]-1-[2-(3-isocyanophenyl)-5-methylpyrazol-3-yl]ethanone (PubChem CID 158617615) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 2-[3-[hydroxy-(3-nitrophenyl)methyl]phenyl]-1-[2-(3-isocyanophenyl)-5-methylpyrazol-3-yl]ethanone.
| Compound Name | 2-[3-[hydroxy-(3-nitrophenyl)methyl]phenyl]-1-[2-(3-isocyanophenyl)-5-methylpyrazol-3-yl]ethanone |
|---|---|
| PubChem CID | 158617615 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[3-[hydroxy-(3-nitrophenyl)methyl]phenyl]-1-[2-(3-isocyanophenyl)-5-methylpyrazol-3-yl]ethanone |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Cc2cccc(C(O)c3cccc([N+](=O)[O-])c3)c2)c1 |
| InChI | InChI=1S/C26H20N4O4/c1-17-12-24(29(28-17)22-10-5-9-21(16-22)27-2)25(31)14-18-6-3-7-19(13-18)26(32)20-8-4-11-23(15-20)30(33)34/h3-13,15-16,26,32H,14H2,1H3 |
| InChIKey | QVKFMXKBTMRENC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|