C26H22N4O5S — CID 158005628
methyl 2-[hydroxy-[3-[[2-(3-isocyanophenyl)-5-methylpyrazole-3-carbonyl]amino]phenyl]methyl]benzenesulfonate (PubChem CID 158005628) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is methyl 2-[hydroxy-[3-[[2-(3-isocyanophenyl)-5-methylpyrazole-3-carbonyl]amino]phenyl]methyl]benzenesulfonate.
| Compound Name | methyl 2-[hydroxy-[3-[[2-(3-isocyanophenyl)-5-methylpyrazole-3-carbonyl]amino]phenyl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 158005628 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | methyl 2-[hydroxy-[3-[[2-(3-isocyanophenyl)-5-methylpyrazole-3-carbonyl]amino]phenyl]methyl]benzenesulfonate |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Nc2cccc(C(O)c3ccccc3S(=O)(=O)OC)c2)c1 |
| InChI | InChI=1S/C26H22N4O5S/c1-17-14-23(30(29-17)21-11-7-9-19(16-21)27-2)26(32)28-20-10-6-8-18(15-20)25(31)22-12-4-5-13-24(22)36(33,34)35-3/h4-16,25,31H,1,3H3,(H,28,32) |
| InChIKey | REDUAGMKKQDDND-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|