C29H26N4O3 — CID 159856718
N-[3-[cyclopropylmethoxy-(4-hydroxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide (PubChem CID 159856718) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[3-[cyclopropylmethoxy-(4-hydroxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-[cyclopropylmethoxy-(4-hydroxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 159856718 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-[3-[cyclopropylmethoxy-(4-hydroxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Nc2cccc(C(OCC3CC3)c3ccc(O)cc3)c2)c1 |
| InChI | InChI=1S/C29H26N4O3/c1-19-15-27(33(32-19)25-8-4-6-23(17-25)30-2)29(35)31-24-7-3-5-22(16-24)28(36-18-20-9-10-20)21-11-13-26(34)14-12-21/h3-8,11-17,20,28,34H,9-10,18H2,1H3,(H,31,35) |
| InChIKey | LGGNFRFUUXTNKA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|