C33H28N4O3 — CID 158071661
N-[3-[hydroxy-(2-methyl-3-phenylmethoxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide (PubChem CID 158071661) has the molecular formula C33H28N4O3 and a molecular weight of 528.61 g/mol. Its IUPAC name is N-[3-[hydroxy-(2-methyl-3-phenylmethoxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-[hydroxy-(2-methyl-3-phenylmethoxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 158071661 |
| Molecular Formula | C33H28N4O3 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | N-[3-[hydroxy-(2-methyl-3-phenylmethoxyphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Nc2cccc(C(O)c3cccc(OCc4ccccc4)c3C)c2)c1 |
| InChI | InChI=1S/C33H28N4O3/c1-22-18-30(37(36-22)28-15-8-13-26(20-28)34-3)33(39)35-27-14-7-12-25(19-27)32(38)29-16-9-17-31(23(29)2)40-21-24-10-5-4-6-11-24/h4-20,32,38H,21H2,1-2H3,(H,35,39) |
| InChIKey | DKGFMYXWHWUVBZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|