C31H24N4O2 — CID 157206103
N-[3-[hydroxy-(4-phenylphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide (PubChem CID 157206103) has the molecular formula C31H24N4O2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[3-[hydroxy-(4-phenylphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-[hydroxy-(4-phenylphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 157206103 |
| Molecular Formula | C31H24N4O2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[3-[hydroxy-(4-phenylphenyl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Nc2cccc(C(O)c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C31H24N4O2/c1-21-18-29(35(34-21)28-13-7-11-26(20-28)32-2)31(37)33-27-12-6-10-25(19-27)30(36)24-16-14-23(15-17-24)22-8-4-3-5-9-22/h3-20,30,36H,1H3,(H,33,37) |
| InChIKey | FWGJSXKXFSFRCJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|