C22H16FN5O2S — CID 158302367
N-[2-fluoro-5-[hydroxy(1,3-thiazol-2-yl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide (PubChem CID 158302367) has the molecular formula C22H16FN5O2S and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[2-fluoro-5-[hydroxy(1,3-thiazol-2-yl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-fluoro-5-[hydroxy(1,3-thiazol-2-yl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 158302367 |
| Molecular Formula | C22H16FN5O2S |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[2-fluoro-5-[hydroxy(1,3-thiazol-2-yl)methyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Nc2cc(C(O)c3nccs3)ccc2F)c1 |
| InChI | InChI=1S/C22H16FN5O2S/c1-13-10-19(28(27-13)16-5-3-4-15(12-16)24-2)21(30)26-18-11-14(6-7-17(18)23)20(29)22-25-8-9-31-22/h3-12,20,29H,1H3,(H,26,30) |
| InChIKey | CJWIJCWNYCUHIT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|