C22H17FN6O — CID 158117022
N-[2-fluoro-5-(imidazol-1-ylmethyl)phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide (PubChem CID 158117022) has the molecular formula C22H17FN6O and a molecular weight of 400.42 g/mol. Its IUPAC name is N-[2-fluoro-5-(imidazol-1-ylmethyl)phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-fluoro-5-(imidazol-1-ylmethyl)phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 158117022 |
| Molecular Formula | C22H17FN6O |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[2-fluoro-5-(imidazol-1-ylmethyl)phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Nc2cc(Cn3ccnc3)ccc2F)c1 |
| InChI | InChI=1S/C22H17FN6O/c1-15-10-21(29(27-15)18-5-3-4-17(12-18)24-2)22(30)26-20-11-16(6-7-19(20)23)13-28-9-8-25-14-28/h3-12,14H,13H2,1H3,(H,26,30) |
| InChIKey | JACXMJUSJUZKQB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|