C28H27N5O2 — CID 158581605
N-[3-[(1-hydroxypropan-2-ylamino)-phenylmethyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide (PubChem CID 158581605) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[3-[(1-hydroxypropan-2-ylamino)-phenylmethyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-[(1-hydroxypropan-2-ylamino)-phenylmethyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 158581605 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[3-[(1-hydroxypropan-2-ylamino)-phenylmethyl]phenyl]-2-(3-isocyanophenyl)-5-methylpyrazole-3-carboxamide |
| SMILES | [C-]#[N+]c1cccc(-n2nc(C)cc2C(=O)Nc2cccc(C(NC(C)CO)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H27N5O2/c1-19-15-26(33(32-19)25-14-8-12-23(17-25)29-3)28(35)31-24-13-7-11-22(16-24)27(30-20(2)18-34)21-9-5-4-6-10-21/h4-17,20,27,30,34H,18H2,1-2H3,(H,31,35) |
| InChIKey | FISZYOCGQVYLNN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|