C20H24F6O7 — CID 158629682
2,2,3,3,4,4-hexafluorododecanoic acid;5-hydroxybenzene-1,3-dicarboxylic acid (PubChem CID 158629682) has the molecular formula C20H24F6O7 and a molecular weight of 490.39 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluorododecanoic acid;5-hydroxybenzene-1,3-dicarboxylic acid.
| Compound Name | 2,2,3,3,4,4-hexafluorododecanoic acid;5-hydroxybenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 158629682 |
| Molecular Formula | C20H24F6O7 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2,2,3,3,4,4-hexafluorododecanoic acid;5-hydroxybenzene-1,3-dicarboxylic acid |
| SMILES | CCCCCCCCC(F)(F)C(F)(F)C(F)(F)C(=O)O.O=C(O)c1cc(O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H18F6O2.C8H6O5/c1-2-3-4-5-6-7-8-10(13,14)12(17,18)11(15,16)9(19)20;9-6-2-4(7(10)11)1-5(3-6)8(12)13/h2-8H2,1H3,(H,19,20);1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | HZANMCDITOGOOO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|