C25H28O2S2 — CID 158640148
1-(4-methoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]ethanone;(4-methylphenyl)methanethiol (PubChem CID 158640148) has the molecular formula C25H28O2S2 and a molecular weight of 424.63 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]ethanone;(4-methylphenyl)methanethiol.
| Compound Name | 1-(4-methoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]ethanone;(4-methylphenyl)methanethiol |
|---|---|
| PubChem CID | 158640148 |
| Molecular Formula | C25H28O2S2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[(4-methylphenyl)methylsulfanyl]ethanone;(4-methylphenyl)methanethiol |
| SMILES | COc1ccc(C(=O)CSCc2ccc(C)cc2)cc1.Cc1ccc(CS)cc1 |
| InChI | InChI=1S/C17H18O2S.C8H10S/c1-13-3-5-14(6-4-13)11-20-12-17(18)15-7-9-16(19-2)10-8-15;1-7-2-4-8(6-9)5-3-7/h3-10H,11-12H2,1-2H3;2-5,9H,6H2,1H3 |
| InChIKey | IAGUCYOFIVWNJK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|