C24H26N4O4 — CID 158641850
9H-fluoren-9-ylmethyl (6S)-6-amino-6-[5-(2-amino-2-oxoethyl)-1,3,4-oxadiazol-2-yl]hexanoate (PubChem CID 158641850) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (6S)-6-amino-6-[5-(2-amino-2-oxoethyl)-1,3,4-oxadiazol-2-yl]hexanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (6S)-6-amino-6-[5-(2-amino-2-oxoethyl)-1,3,4-oxadiazol-2-yl]hexanoate |
|---|---|
| PubChem CID | 158641850 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (6S)-6-amino-6-[5-(2-amino-2-oxoethyl)-1,3,4-oxadiazol-2-yl]hexanoate |
| SMILES | NC(=O)Cc1nnc([C@@H](N)CCCCC(=O)OCC2c3ccccc3-c3ccccc32)o1 |
| InChI | InChI=1S/C24H26N4O4/c25-20(24-28-27-22(32-24)13-21(26)29)11-5-6-12-23(30)31-14-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-4,7-10,19-20H,5-6,11-14,25H2,(H2,26,29)/t20-/m0/s1 |
| InChIKey | SUBJCSPTFOKFKU-FQEVSTJZSA-N |
| XLogP | 3.01 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|