C21H19NO4S — CID 158647953
4-[3-(5-acetylthiophen-2-yl)-3-oxopropyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 158647953) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 4-[3-(5-acetylthiophen-2-yl)-3-oxopropyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-[3-(5-acetylthiophen-2-yl)-3-oxopropyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 158647953 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-[3-(5-acetylthiophen-2-yl)-3-oxopropyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CC(=O)c1ccc(C(=O)CCc2ccc(C(=O)NCc3ccco3)cc2)s1 |
| InChI | InChI=1S/C21H19NO4S/c1-14(23)19-10-11-20(27-19)18(24)9-6-15-4-7-16(8-5-15)21(25)22-13-17-3-2-12-26-17/h2-5,7-8,10-12H,6,9,13H2,1H3,(H,22,25) |
| InChIKey | UFMNQHFFBADQKB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |