C24H25N3O3 — CID 158648022
1-[4-[2-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carbonyl]azetidin-3-yl]ethynyl]phenyl]cyclopropane-1-carbonitrile (PubChem CID 158648022) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[4-[2-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carbonyl]azetidin-3-yl]ethynyl]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[2-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carbonyl]azetidin-3-yl]ethynyl]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 158648022 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-[4-[2-[1-[(4aR,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carbonyl]azetidin-3-yl]ethynyl]phenyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2ccc(C#CC3CN(C(=O)N4CC[C@@H]5OCC(=O)C[C@@H]5C4)C3)cc2)CC1 |
| InChI | InChI=1S/C24H25N3O3/c25-16-24(8-9-24)20-5-3-17(4-6-20)1-2-18-12-27(13-18)23(29)26-10-7-22-19(14-26)11-21(28)15-30-22/h3-6,18-19,22H,7-15H2/t19-,22+/m1/s1 |
| InChIKey | IBEZUFYUPYNJHV-KNQAVFIVSA-N |
| XLogP | 2.32 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|