C34H68 — CID 158656584
1-tert-butyladamantane;2,2,3,3,5,5-hexamethylhexane;2,2,3,3-tetramethylbutane (PubChem CID 158656584) has the molecular formula C34H68 and a molecular weight of 476.92 g/mol. Its IUPAC name is 1-tert-butyladamantane;2,2,3,3,5,5-hexamethylhexane;2,2,3,3-tetramethylbutane.
| Compound Name | 1-tert-butyladamantane;2,2,3,3,5,5-hexamethylhexane;2,2,3,3-tetramethylbutane |
|---|---|
| PubChem CID | 158656584 |
| Molecular Formula | C34H68 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.53 |
| IUPAC Name | 1-tert-butyladamantane;2,2,3,3,5,5-hexamethylhexane;2,2,3,3-tetramethylbutane |
| SMILES | CC(C)(C)C(C)(C)C.CC(C)(C)C12CC3CC(CC(C3)C1)C2.CC(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24.C12H26.C8H18/c1-13(2,3)14-7-10-4-11(8-14)6-12(5-10)9-14;1-10(2,3)9-12(7,8)11(4,5)6;1-7(2,3)8(4,5)6/h10-12H,4-9H2,1-3H3;9H2,1-8H3;1-6H3 |
| InChIKey | ICFFFFRRGMQWOK-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |