C37H58N2O6 — CID 158694689
(1S,2S,3S,4R,5S)-2-amino-5-ethyl-4-methyl-3-phenylmethoxycyclohexan-1-ol;tert-butyl N-[(1S,2S,3R,4S,6S)-4-ethyl-6-hydroxy-3-methyl-2-phenylmethoxycyclohexyl]carbamate (PubChem CID 158694689) has the molecular formula C37H58N2O6 and a molecular weight of 626.88 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-2-amino-5-ethyl-4-methyl-3-phenylmethoxycyclohexan-1-ol;tert-butyl N-[(1S,2S,3R,4S,6S)-4-ethyl-6-hydroxy-3-methyl-2-phenylmethoxycyclohexyl]carbamate.
| Compound Name | (1S,2S,3S,4R,5S)-2-amino-5-ethyl-4-methyl-3-phenylmethoxycyclohexan-1-ol;tert-butyl N-[(1S,2S,3R,4S,6S)-4-ethyl-6-hydroxy-3-methyl-2-phenylmethoxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 158694689 |
| Molecular Formula | C37H58N2O6 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.43 |
| IUPAC Name | (1S,2S,3S,4R,5S)-2-amino-5-ethyl-4-methyl-3-phenylmethoxycyclohexan-1-ol;tert-butyl N-[(1S,2S,3R,4S,6S)-4-ethyl-6-hydroxy-3-methyl-2-phenylmethoxycyclohexyl]carbamate |
| SMILES | CC[C@H]1C[C@H](O)[C@H](N)[C@@H](OCc2ccccc2)[C@@H]1C.CC[C@H]1C[C@H](O)[C@H](NC(=O)OC(C)(C)C)[C@@H](OCc2ccccc2)C1C |
| InChI | InChI=1S/C21H33NO4.C16H25NO2/c1-6-16-12-17(23)18(22-20(24)26-21(3,4)5)19(14(16)2)25-13-15-10-8-7-9-11-15;1-3-13-9-14(18)15(17)16(11(13)2)19-10-12-7-5-4-6-8-12/h7-11,14,16-19,23H,6,12-13H2,1-5H3,(H,22,24);4-8,11,13-16,18H,3,9-10,17H2,1-2H3/t14?,16-,17-,18-,19-;11-,13+,14+,15+,16+/m01/s1 |
| InChIKey | IGUDPHNWPRKYGQ-KJZDZEKUSA-N |
| XLogP | 6.22 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |